C23H26BrFN2O3S — CID 122658668
N-[[1-(3-bromo-4-fluorophenyl)-2-(hydroxymethyl)-4-propan-2-yloxycyclopentyl]carbamothioyl]benzamide (PubChem CID 122658668) has the molecular formula C23H26BrFN2O3S and a molecular weight of 509.44 g/mol. Its IUPAC name is N-[[1-(3-bromo-4-fluorophenyl)-2-(hydroxymethyl)-4-propan-2-yloxycyclopentyl]carbamothioyl]benzamide.
| Compound Name | N-[[1-(3-bromo-4-fluorophenyl)-2-(hydroxymethyl)-4-propan-2-yloxycyclopentyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 122658668 |
| Molecular Formula | C23H26BrFN2O3S |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | N-[[1-(3-bromo-4-fluorophenyl)-2-(hydroxymethyl)-4-propan-2-yloxycyclopentyl]carbamothioyl]benzamide |
| SMILES | CC(C)OC1CC(CO)C(NC(=S)NC(=O)c2ccccc2)(c2ccc(F)c(Br)c2)C1 |
| InChI | InChI=1S/C23H26BrFN2O3S/c1-14(2)30-18-10-17(13-28)23(12-18,16-8-9-20(25)19(24)11-16)27-22(31)26-21(29)15-6-4-3-5-7-15/h3-9,11,14,17-18,28H,10,12-13H2,1-2H3,(H2,26,27,29,31) |
| InChIKey | WRLZSSLLQQRCAU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|