C24H26F2N2O3S — CID 90253450
N-[[(3S,4R,6R)-6-cyclopropyl-3-(2,4-difluorophenyl)-4-[(1S)-1-hydroxyethyl]oxan-3-yl]carbamothioyl]benzamide (PubChem CID 90253450) has the molecular formula C24H26F2N2O3S and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[[(3S,4R,6R)-6-cyclopropyl-3-(2,4-difluorophenyl)-4-[(1S)-1-hydroxyethyl]oxan-3-yl]carbamothioyl]benzamide.
| Compound Name | N-[[(3S,4R,6R)-6-cyclopropyl-3-(2,4-difluorophenyl)-4-[(1S)-1-hydroxyethyl]oxan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 90253450 |
| Molecular Formula | C24H26F2N2O3S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[[(3S,4R,6R)-6-cyclopropyl-3-(2,4-difluorophenyl)-4-[(1S)-1-hydroxyethyl]oxan-3-yl]carbamothioyl]benzamide |
| SMILES | C[C@H](O)[C@@H]1C[C@H](C2CC2)OC[C@@]1(NC(=S)NC(=O)c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H26F2N2O3S/c1-14(29)19-12-21(15-7-8-15)31-13-24(19,18-10-9-17(25)11-20(18)26)28-23(32)27-22(30)16-5-3-2-4-6-16/h2-6,9-11,14-15,19,21,29H,7-8,12-13H2,1H3,(H2,27,28,30,32)/t14-,19-,21+,24+/m0/s1 |
| InChIKey | PEOVZTIYFRPZNK-IJUABRMXSA-N |
| XLogP | 3.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|