C18H20BrN3O3S2 — CID 118435603
N-[[(3R,4R,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-(hydroxymethyl)-6-methyloxan-3-yl]carbamothioyl]benzamide (PubChem CID 118435603) has the molecular formula C18H20BrN3O3S2 and a molecular weight of 470.41 g/mol. Its IUPAC name is N-[[(3R,4R,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-(hydroxymethyl)-6-methyloxan-3-yl]carbamothioyl]benzamide.
| Compound Name | N-[[(3R,4R,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-(hydroxymethyl)-6-methyloxan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 118435603 |
| Molecular Formula | C18H20BrN3O3S2 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | N-[[(3R,4R,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-(hydroxymethyl)-6-methyloxan-3-yl]carbamothioyl]benzamide |
| SMILES | C[C@H]1C[C@@H](CO)[C@](NC(=S)NC(=O)c2ccccc2)(c2nc(Br)cs2)CO1 |
| InChI | InChI=1S/C18H20BrN3O3S2/c1-11-7-13(8-23)18(10-25-11,16-20-14(19)9-27-16)22-17(26)21-15(24)12-5-3-2-4-6-12/h2-6,9,11,13,23H,7-8,10H2,1H3,(H2,21,22,24,26)/t11-,13-,18-/m0/s1 |
| InChIKey | JFBLKVJGORMTLO-FNFWKMNBSA-N |
| XLogP | 2.82 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|