C23H24F2N2O3S — CID 123518979
N-[[6-cyclopropyl-3-(2,4-difluorophenyl)-4-(hydroxymethyl)oxan-3-yl]carbamothioyl]benzamide (PubChem CID 123518979) has the molecular formula C23H24F2N2O3S and a molecular weight of 446.52 g/mol. Its IUPAC name is N-[[6-cyclopropyl-3-(2,4-difluorophenyl)-4-(hydroxymethyl)oxan-3-yl]carbamothioyl]benzamide.
| Compound Name | N-[[6-cyclopropyl-3-(2,4-difluorophenyl)-4-(hydroxymethyl)oxan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 123518979 |
| Molecular Formula | C23H24F2N2O3S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[[6-cyclopropyl-3-(2,4-difluorophenyl)-4-(hydroxymethyl)oxan-3-yl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)NC1(c2ccc(F)cc2F)COC(C2CC2)CC1CO)c1ccccc1 |
| InChI | InChI=1S/C23H24F2N2O3S/c24-17-8-9-18(19(25)11-17)23(13-30-20(14-6-7-14)10-16(23)12-28)27-22(31)26-21(29)15-4-2-1-3-5-15/h1-5,8-9,11,14,16,20,28H,6-7,10,12-13H2,(H2,26,27,29,31) |
| InChIKey | VQTPRZDQSDYKNB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|