C28H29FN2O3S — CID 91334876
N-[[(1S,2S,4S)-1-(2-fluorophenyl)-2-(hydroxymethyl)-4-phenylmethoxycyclohexyl]carbamothioyl]benzamide (PubChem CID 91334876) has the molecular formula C28H29FN2O3S and a molecular weight of 492.62 g/mol. Its IUPAC name is N-[[(1S,2S,4S)-1-(2-fluorophenyl)-2-(hydroxymethyl)-4-phenylmethoxycyclohexyl]carbamothioyl]benzamide.
| Compound Name | N-[[(1S,2S,4S)-1-(2-fluorophenyl)-2-(hydroxymethyl)-4-phenylmethoxycyclohexyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 91334876 |
| Molecular Formula | C28H29FN2O3S |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-[[(1S,2S,4S)-1-(2-fluorophenyl)-2-(hydroxymethyl)-4-phenylmethoxycyclohexyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)N[C@@]1(c2ccccc2F)CC[C@H](OCc2ccccc2)C[C@@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C28H29FN2O3S/c29-25-14-8-7-13-24(25)28(31-27(35)30-26(33)21-11-5-2-6-12-21)16-15-23(17-22(28)18-32)34-19-20-9-3-1-4-10-20/h1-14,22-23,32H,15-19H2,(H2,30,31,33,35)/t22-,23+,28+/m1/s1 |
| InChIKey | PGHMUHHYHIRGNU-IWHLBADBSA-N |
| XLogP | 4.70 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|