C29H32BrFN2O4S — CID 144644002
N-[[3-(5-bromo-2-fluorophenyl)-4-(1-hydroxyethyl)oxan-3-yl]carbamothioyl]benzamide;methoxymethylbenzene (PubChem CID 144644002) has the molecular formula C29H32BrFN2O4S and a molecular weight of 603.55 g/mol. Its IUPAC name is N-[[3-(5-bromo-2-fluorophenyl)-4-(1-hydroxyethyl)oxan-3-yl]carbamothioyl]benzamide;methoxymethylbenzene.
| Compound Name | N-[[3-(5-bromo-2-fluorophenyl)-4-(1-hydroxyethyl)oxan-3-yl]carbamothioyl]benzamide;methoxymethylbenzene |
|---|---|
| PubChem CID | 144644002 |
| Molecular Formula | C29H32BrFN2O4S |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | N-[[3-(5-bromo-2-fluorophenyl)-4-(1-hydroxyethyl)oxan-3-yl]carbamothioyl]benzamide;methoxymethylbenzene |
| SMILES | CC(O)C1CCOCC1(NC(=S)NC(=O)c1ccccc1)c1cc(Br)ccc1F.COCc1ccccc1 |
| InChI | InChI=1S/C21H22BrFN2O3S.C8H10O/c1-13(26)16-9-10-28-12-21(16,17-11-15(22)7-8-18(17)23)25-20(29)24-19(27)14-5-3-2-4-6-14;1-9-7-8-5-3-2-4-6-8/h2-8,11,13,16,26H,9-10,12H2,1H3,(H2,24,25,27,29);2-6H,7H2,1H3 |
| InChIKey | UMTFCHHSPYCMOK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|