C24H26F2N2O3S — CID 123345809
N-[[3-(2,4-difluorophenyl)-4-(hydroxymethyl)-6-(1-methylcyclopropyl)oxan-3-yl]carbamothioyl]benzamide (PubChem CID 123345809) has the molecular formula C24H26F2N2O3S and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[[3-(2,4-difluorophenyl)-4-(hydroxymethyl)-6-(1-methylcyclopropyl)oxan-3-yl]carbamothioyl]benzamide.
| Compound Name | N-[[3-(2,4-difluorophenyl)-4-(hydroxymethyl)-6-(1-methylcyclopropyl)oxan-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 123345809 |
| Molecular Formula | C24H26F2N2O3S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[[3-(2,4-difluorophenyl)-4-(hydroxymethyl)-6-(1-methylcyclopropyl)oxan-3-yl]carbamothioyl]benzamide |
| SMILES | CC1(C2CC(CO)C(NC(=S)NC(=O)c3ccccc3)(c3ccc(F)cc3F)CO2)CC1 |
| InChI | InChI=1S/C24H26F2N2O3S/c1-23(9-10-23)20-11-16(13-29)24(14-31-20,18-8-7-17(25)12-19(18)26)28-22(32)27-21(30)15-5-3-2-4-6-15/h2-8,12,16,20,29H,9-11,13-14H2,1H3,(H2,27,28,30,32) |
| InChIKey | MHBBWKOHEWZZFR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|