C24H27F2N3O4S — CID 90068823
tert-butyl (3S,4R)-3-(benzoylcarbamothioylamino)-3-(2,5-difluorophenyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 90068823) has the molecular formula C24H27F2N3O4S and a molecular weight of 491.56 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(benzoylcarbamothioylamino)-3-(2,5-difluorophenyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-(benzoylcarbamothioylamino)-3-(2,5-difluorophenyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90068823 |
| Molecular Formula | C24H27F2N3O4S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | tert-butyl (3S,4R)-3-(benzoylcarbamothioylamino)-3-(2,5-difluorophenyl)-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CO)[C@](NC(=S)NC(=O)c2ccccc2)(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C24H27F2N3O4S/c1-23(2,3)33-22(32)29-12-16(13-30)24(14-29,18-11-17(25)9-10-19(18)26)28-21(34)27-20(31)15-7-5-4-6-8-15/h4-11,16,30H,12-14H2,1-3H3,(H2,27,28,31,34)/t16-,24-/m0/s1 |
| InChIKey | BHXJNDDGVYWLMP-FYSMJZIKSA-N |
| XLogP | 3.32 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|