C20H22BrN3O3S2 — CID 126715608
N-[[(7R,8R)-7-(4-bromo-1,3-thiazol-2-yl)-8-(hydroxymethyl)-5-oxaspiro[3.5]nonan-7-yl]carbamothioyl]benzamide (PubChem CID 126715608) has the molecular formula C20H22BrN3O3S2 and a molecular weight of 496.45 g/mol. Its IUPAC name is N-[[(7R,8R)-7-(4-bromo-1,3-thiazol-2-yl)-8-(hydroxymethyl)-5-oxaspiro[3.5]nonan-7-yl]carbamothioyl]benzamide.
| Compound Name | N-[[(7R,8R)-7-(4-bromo-1,3-thiazol-2-yl)-8-(hydroxymethyl)-5-oxaspiro[3.5]nonan-7-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 126715608 |
| Molecular Formula | C20H22BrN3O3S2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | N-[[(7R,8R)-7-(4-bromo-1,3-thiazol-2-yl)-8-(hydroxymethyl)-5-oxaspiro[3.5]nonan-7-yl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)N[C@@]1(c2nc(Br)cs2)COC2(CCC2)C[C@H]1CO)c1ccccc1 |
| InChI | InChI=1S/C20H22BrN3O3S2/c21-15-11-29-17(22-15)20(12-27-19(7-4-8-19)9-14(20)10-25)24-18(28)23-16(26)13-5-2-1-3-6-13/h1-3,5-6,11,14,25H,4,7-10,12H2,(H2,23,24,26,28)/t14-,20-/m0/s1 |
| InChIKey | GYGIKZLHAYJNPG-XOBRGWDASA-N |
| XLogP | 3.36 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|