C19H21BrN2O3S — CID 126737552
benzyl N-[(3R,4S,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-ethenyl-6-methyloxan-3-yl]carbamate (PubChem CID 126737552) has the molecular formula C19H21BrN2O3S and a molecular weight of 437.36 g/mol. Its IUPAC name is benzyl N-[(3R,4S,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-ethenyl-6-methyloxan-3-yl]carbamate.
| Compound Name | benzyl N-[(3R,4S,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-ethenyl-6-methyloxan-3-yl]carbamate |
|---|---|
| PubChem CID | 126737552 |
| Molecular Formula | C19H21BrN2O3S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | benzyl N-[(3R,4S,6S)-3-(4-bromo-1,3-thiazol-2-yl)-4-ethenyl-6-methyloxan-3-yl]carbamate |
| SMILES | C=C[C@@H]1C[C@H](C)OC[C@@]1(NC(=O)OCc1ccccc1)c1nc(Br)cs1 |
| InChI | InChI=1S/C19H21BrN2O3S/c1-3-15-9-13(2)25-12-19(15,17-21-16(20)11-26-17)22-18(23)24-10-14-7-5-4-6-8-14/h3-8,11,13,15H,1,9-10,12H2,2H3,(H,22,23)/t13-,15+,19-/m0/s1 |
| InChIKey | LKZBYNOUVISSKI-OHNRDTAOSA-N |
| XLogP | 4.64 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|