C17H23N2O5P — CID 87142650
benzyl N-[2-ethenyl-1-[[ethoxy(methyl)phosphoryl]carbonylamino]cyclopropyl]carbamate (PubChem CID 87142650) has the molecular formula C17H23N2O5P and a molecular weight of 366.35 g/mol. Its IUPAC name is benzyl N-[2-ethenyl-1-[[ethoxy(methyl)phosphoryl]carbonylamino]cyclopropyl]carbamate.
| Compound Name | benzyl N-[2-ethenyl-1-[[ethoxy(methyl)phosphoryl]carbonylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 87142650 |
| Molecular Formula | C17H23N2O5P |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | benzyl N-[2-ethenyl-1-[[ethoxy(methyl)phosphoryl]carbonylamino]cyclopropyl]carbamate |
| SMILES | C=CC1CC1(NC(=O)OCc1ccccc1)NC(=O)P(C)(=O)OCC |
| InChI | InChI=1S/C17H23N2O5P/c1-4-14-11-17(14,19-16(21)25(3,22)24-5-2)18-15(20)23-12-13-9-7-6-8-10-13/h4,6-10,14H,1,5,11-12H2,2-3H3,(H,18,20)(H,19,21) |
| InChIKey | YQMNLSSUBRVUSF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|