C34H48N2O9P2 — CID 158212071
benzyl N-[(1S,2S)-1-[butyl(ethoxy)phosphoryl]-2-ethenylcyclopropyl]carbamate;[(1S,2S)-2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]-ethoxyphosphinic acid (PubChem CID 158212071) has the molecular formula C34H48N2O9P2 and a molecular weight of 690.71 g/mol. Its IUPAC name is benzyl N-[(1S,2S)-1-[butyl(ethoxy)phosphoryl]-2-ethenylcyclopropyl]carbamate;[(1S,2S)-2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]-ethoxyphosphinic acid.
| Compound Name | benzyl N-[(1S,2S)-1-[butyl(ethoxy)phosphoryl]-2-ethenylcyclopropyl]carbamate;[(1S,2S)-2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 158212071 |
| Molecular Formula | C34H48N2O9P2 |
| Molecular Weight | 690.71 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | benzyl N-[(1S,2S)-1-[butyl(ethoxy)phosphoryl]-2-ethenylcyclopropyl]carbamate;[(1S,2S)-2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]-ethoxyphosphinic acid |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)OCc1ccccc1)P(=O)(CCCC)OCC.C=C[C@@H]1C[C@]1(NC(=O)OCc1ccccc1)P(=O)(O)OCC |
| InChI | InChI=1S/C19H28NO4P.C15H20NO5P/c1-4-7-13-25(22,24-6-3)19(14-17(19)5-2)20-18(21)23-15-16-11-9-8-10-12-16;1-3-13-10-15(13,22(18,19)21-4-2)16-14(17)20-11-12-8-6-5-7-9-12/h5,8-12,17H,2,4,6-7,13-15H2,1,3H3,(H,20,21);3,5-9,13H,1,4,10-11H2,2H3,(H,16,17)(H,18,19)/t17-,19+,25?;13-,15+/m11/s1 |
| InChIKey | GCEWESOMZYOFFI-XGUOESLDSA-N |
| XLogP | 7.97 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.71 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|