C17H23NO4P+ — CID 67206620
2-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]ethyl-ethoxy-oxophosphanium (PubChem CID 67206620) has the molecular formula C17H23NO4P+ and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]ethyl-ethoxy-oxophosphanium.
| Compound Name | 2-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]ethyl-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 67206620 |
| Molecular Formula | C17H23NO4P+ |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]ethyl-ethoxy-oxophosphanium |
| SMILES | C=CC1CC1(CC[P+](=O)OCC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H22NO4P/c1-3-15-12-17(15,10-11-23(20)22-4-2)18-16(19)21-13-14-8-6-5-7-9-14/h3,5-9,15H,1,4,10-13H2,2H3/p+1 |
| InChIKey | OITRXMQWVVJMOS-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|