C16H20N4O4 — CID 72975144
methyl 2-[2-(2-azidoethyl)-1-(phenylmethoxycarbonylamino)cyclopropyl]acetate (PubChem CID 72975144) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl 2-[2-(2-azidoethyl)-1-(phenylmethoxycarbonylamino)cyclopropyl]acetate.
| Compound Name | methyl 2-[2-(2-azidoethyl)-1-(phenylmethoxycarbonylamino)cyclopropyl]acetate |
|---|---|
| PubChem CID | 72975144 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | methyl 2-[2-(2-azidoethyl)-1-(phenylmethoxycarbonylamino)cyclopropyl]acetate |
| SMILES | COC(=O)CC1(NC(=O)OCc2ccccc2)CC1CCN=[N+]=[N-] |
| InChI | InChI=1S/C16H20N4O4/c1-23-14(21)10-16(9-13(16)7-8-18-20-17)19-15(22)24-11-12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,19,22) |
| InChIKey | CIOHFOFSBGOVOQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|