C17H24NO4P — CID 141136857
butan-2-yl-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]phosphinic acid (PubChem CID 141136857) has the molecular formula C17H24NO4P and a molecular weight of 337.36 g/mol. Its IUPAC name is butan-2-yl-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]phosphinic acid.
| Compound Name | butan-2-yl-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]phosphinic acid |
|---|---|
| PubChem CID | 141136857 |
| Molecular Formula | C17H24NO4P |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | butan-2-yl-[2-ethenyl-1-(phenylmethoxycarbonylamino)cyclopropyl]phosphinic acid |
| SMILES | C=CC1CC1(NC(=O)OCc1ccccc1)P(=O)(O)C(C)CC |
| InChI | InChI=1S/C17H24NO4P/c1-4-13(3)23(20,21)17(11-15(17)5-2)18-16(19)22-12-14-9-7-6-8-10-14/h5-10,13,15H,2,4,11-12H2,1,3H3,(H,18,19)(H,20,21) |
| InChIKey | OASBGQXSDVPBQI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|