C22H24ClFNO4P — CID 66770344
benzyl N-[1-[(2-chloro-6-fluorophenyl)methyl-ethoxyphosphoryl]-2-ethenylcyclopropyl]carbamate (PubChem CID 66770344) has the molecular formula C22H24ClFNO4P and a molecular weight of 451.86 g/mol. Its IUPAC name is benzyl N-[1-[(2-chloro-6-fluorophenyl)methyl-ethoxyphosphoryl]-2-ethenylcyclopropyl]carbamate.
| Compound Name | benzyl N-[1-[(2-chloro-6-fluorophenyl)methyl-ethoxyphosphoryl]-2-ethenylcyclopropyl]carbamate |
|---|---|
| PubChem CID | 66770344 |
| Molecular Formula | C22H24ClFNO4P |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | benzyl N-[1-[(2-chloro-6-fluorophenyl)methyl-ethoxyphosphoryl]-2-ethenylcyclopropyl]carbamate |
| SMILES | C=CC1CC1(NC(=O)OCc1ccccc1)P(=O)(Cc1c(F)cccc1Cl)OCC |
| InChI | InChI=1S/C22H24ClFNO4P/c1-3-17-13-22(17,25-21(26)28-14-16-9-6-5-7-10-16)30(27,29-4-2)15-18-19(23)11-8-12-20(18)24/h3,5-12,17H,1,4,13-15H2,2H3,(H,25,26) |
| InChIKey | OPXSRMNUKMJWLN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|