C18H17BrI2N2O3S — CID 126726862
[(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)-5,5-bis(iodomethyl)-3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazol-1-yl]-phenylmethanone (PubChem CID 126726862) has the molecular formula C18H17BrI2N2O3S and a molecular weight of 675.12 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)-5,5-bis(iodomethyl)-3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazol-1-yl]-phenylmethanone.
| Compound Name | [(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)-5,5-bis(iodomethyl)-3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 126726862 |
| Molecular Formula | C18H17BrI2N2O3S |
| Molecular Weight | 675.12 g/mol |
| Exact Mass | 673.82 |
| IUPAC Name | [(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)-5,5-bis(iodomethyl)-3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1OC[C@@H]2CC(CI)(CI)OC[C@@]21c1nc(Br)cs1 |
| InChI | InChI=1S/C18H17BrI2N2O3S/c19-14-8-27-16(22-14)18-11-25-17(9-20,10-21)6-13(18)7-26-23(18)15(24)12-4-2-1-3-5-12/h1-5,8,13H,6-7,9-11H2/t13-,18-/m0/s1 |
| InChIKey | RQCHYMCQULVKLJ-UGSOOPFHSA-N |
| XLogP | 4.83 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.12 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|