C23H27F3N4O2S — CID 90026067
N-[[1-tert-butyl-4-(hydroxymethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]carbamothioyl]benzamide (PubChem CID 90026067) has the molecular formula C23H27F3N4O2S and a molecular weight of 480.56 g/mol. Its IUPAC name is N-[[1-tert-butyl-4-(hydroxymethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]carbamothioyl]benzamide.
| Compound Name | N-[[1-tert-butyl-4-(hydroxymethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 90026067 |
| Molecular Formula | C23H27F3N4O2S |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[[1-tert-butyl-4-(hydroxymethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)N1CC(CO)C(NC(=S)NC(=O)c2ccccc2)(c2cc(C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C23H27F3N4O2S/c1-21(2,3)30-12-17(13-31)22(14-30,18-11-16(9-10-27-18)23(24,25)26)29-20(33)28-19(32)15-7-5-4-6-8-15/h4-11,17,31H,12-14H2,1-3H3,(H2,28,29,32,33) |
| InChIKey | SHPKZFXJRMAHLC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|