C16H16F3N3O — CID 138020244
2-anilino-2-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide (PubChem CID 138020244) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-anilino-2-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide.
| Compound Name | 2-anilino-2-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 138020244 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-anilino-2-methyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide |
| SMILES | CC(C)(Nc1ccccc1)C(=O)Nc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C16H16F3N3O/c1-15(2,22-12-6-4-3-5-7-12)14(23)21-13-10-11(8-9-20-13)16(17,18)19/h3-10,22H,1-2H3,(H,20,21,23) |
| InChIKey | ISYAEZMEKFTJHN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |