C11H7F9N2O — CID 170315431
2,2,3,3,4,4-hexafluoro-N-[4-(trifluoromethyl)-2-pyridinyl]pentanamide (PubChem CID 170315431) has the molecular formula C11H7F9N2O and a molecular weight of 354.17 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-N-[4-(trifluoromethyl)-2-pyridinyl]pentanamide.
| Compound Name | 2,2,3,3,4,4-hexafluoro-N-[4-(trifluoromethyl)-2-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 170315431 |
| Molecular Formula | C11H7F9N2O |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-N-[4-(trifluoromethyl)-2-pyridinyl]pentanamide |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(=O)Nc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H7F9N2O/c1-8(12,13)11(19,20)9(14,15)7(23)22-6-4-5(2-3-21-6)10(16,17)18/h2-4H,1H3,(H,21,22,23) |
| InChIKey | WHPVJEFQDXEMST-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|