C10H12F3N3OS — CID 154798205
1-(2-methylsulfanylethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 154798205) has the molecular formula C10H12F3N3OS and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-(2-methylsulfanylethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-(2-methylsulfanylethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 154798205 |
| Molecular Formula | C10H12F3N3OS |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-(2-methylsulfanylethyl)-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | CSCCNC(=O)Nc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C10H12F3N3OS/c1-18-5-4-15-9(17)16-8-6-7(2-3-14-8)10(11,12)13/h2-3,6H,4-5H2,1H3,(H2,14,15,16,17) |
| InChIKey | KJKSRXKWGYBDAU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|