C11H12F3N3O4 — CID 144825954
methyl 2-[methoxy-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]amino]acetate (PubChem CID 144825954) has the molecular formula C11H12F3N3O4 and a molecular weight of 307.23 g/mol. Its IUPAC name is methyl 2-[methoxy-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]amino]acetate.
| Compound Name | methyl 2-[methoxy-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 144825954 |
| Molecular Formula | C11H12F3N3O4 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | methyl 2-[methoxy-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]amino]acetate |
| SMILES | COC(=O)CN(OC)C(=O)Nc1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C11H12F3N3O4/c1-20-9(18)6-17(21-2)10(19)16-8-5-7(3-4-15-8)11(12,13)14/h3-5H,6H2,1-2H3,(H,15,16,19) |
| InChIKey | BRONXJOVPXJNFX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|