C11H13Cl3N2O — CID 15156839
2,2-dimethyl-N-[4-(trichloromethyl)-2-pyridinyl]propanamide (PubChem CID 15156839) has the molecular formula C11H13Cl3N2O and a molecular weight of 295.60 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(trichloromethyl)-2-pyridinyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-(trichloromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 15156839 |
| Molecular Formula | C11H13Cl3N2O |
| Molecular Weight | 295.60 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2,2-dimethyl-N-[4-(trichloromethyl)-2-pyridinyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(C(Cl)(Cl)Cl)ccn1 |
| InChI | InChI=1S/C11H13Cl3N2O/c1-10(2,3)9(17)16-8-6-7(4-5-15-8)11(12,13)14/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | QGTPGIYWSOIUOJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|