About N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide
N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide (PubChem CID 12623303) has the molecular formula C13H14N2OS
and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 12623303 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide |
| SMILES | C=C1SC(NC(=O)c2ccccc2)=NC1(C)C |
| InChI | InChI=1S/C13H14N2OS/c1-9-13(2,3)15-12(17-9)14-11(16)10-7-5-4-6-8-10/h4-8H,1H2,2-3H3,(H,14,15,16) |
| InChIKey | GOJRNHMEZSHYIW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide?
The IUPAC name of N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide (CID 12623303) is N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide is C=C1SC(NC(=O)c2ccccc2)=NC1(C)C.
What is the InChIKey of N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide?
The InChIKey is GOJRNHMEZSHYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2OS/c1-9-13(2,3)15-12(17-9)14-11(16)10-7-5-4-6-8-10/h4-8H,1H2,2-3H3,(H,14,15,16).
What are the key properties of N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide?
N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide has a molecular weight of 246.33 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethyl-5-methylidene-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 12623303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).