C17H12N2OS3 — CID 134908436
N-(7-phenyl-1λ4,2,8-trithia-4-azabicyclo[3.3.0]octa-1(5),3,6-trien-3-yl)benzamide (PubChem CID 134908436) has the molecular formula C17H12N2OS3 and a molecular weight of 356.50 g/mol. Its IUPAC name is N-(7-phenyl-1λ4,2,8-trithia-4-azabicyclo[3.3.0]octa-1(5),3,6-trien-3-yl)benzamide.
| Compound Name | N-(7-phenyl-1λ4,2,8-trithia-4-azabicyclo[3.3.0]octa-1(5),3,6-trien-3-yl)benzamide |
|---|---|
| PubChem CID | 134908436 |
| Molecular Formula | C17H12N2OS3 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | N-(7-phenyl-1λ4,2,8-trithia-4-azabicyclo[3.3.0]octa-1(5),3,6-trien-3-yl)benzamide |
| SMILES | O=C(NC1=NC2=S(SC(c3ccccc3)=C2)S1)c1ccccc1 |
| InChI | InChI=1S/C17H12N2OS3/c20-16(13-9-5-2-6-10-13)19-17-18-15-11-14(21-23(15)22-17)12-7-3-1-4-8-12/h1-11H,(H,18,19,20) |
| InChIKey | BWQFKCPIHLLJQY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|