C15H20FN3OS — CID 123453243
4-(5-amino-2-fluorophenyl)-4-ethenyl-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 123453243) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-(5-amino-2-fluorophenyl)-4-ethenyl-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 4-(5-amino-2-fluorophenyl)-4-ethenyl-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 123453243 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-(5-amino-2-fluorophenyl)-4-ethenyl-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | C=CC1(c2cc(N)ccc2F)CC(CCOC)SC(N)=N1 |
| InChI | InChI=1S/C15H20FN3OS/c1-3-15(12-8-10(17)4-5-13(12)16)9-11(6-7-20-2)21-14(18)19-15/h3-5,8,11H,1,6-7,9,17H2,2H3,(H2,18,19) |
| InChIKey | RJCIUIIZGNVPKS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|