C12H16FNO2 — CID 14708881
4-fluoro-3-(2,4,5-trimethyl-1,3-dioxolan-2-yl)aniline (PubChem CID 14708881) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 4-fluoro-3-(2,4,5-trimethyl-1,3-dioxolan-2-yl)aniline.
| Compound Name | 4-fluoro-3-(2,4,5-trimethyl-1,3-dioxolan-2-yl)aniline |
|---|---|
| PubChem CID | 14708881 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-fluoro-3-(2,4,5-trimethyl-1,3-dioxolan-2-yl)aniline |
| SMILES | CC1OC(C)(c2cc(N)ccc2F)OC1C |
| InChI | InChI=1S/C12H16FNO2/c1-7-8(2)16-12(3,15-7)10-6-9(14)4-5-11(10)13/h4-8H,14H2,1-3H3 |
| InChIKey | NLFUEXHPCRLIFO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|