C12H13F4N3 — CID 121433110
(4R,5S)-5-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-3,4-dihydropyrrol-2-amine (PubChem CID 121433110) has the molecular formula C12H13F4N3 and a molecular weight of 275.25 g/mol. Its IUPAC name is (4R,5S)-5-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-3,4-dihydropyrrol-2-amine.
| Compound Name | (4R,5S)-5-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-3,4-dihydropyrrol-2-amine |
|---|---|
| PubChem CID | 121433110 |
| Molecular Formula | C12H13F4N3 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (4R,5S)-5-(5-amino-2-fluorophenyl)-5-methyl-4-(trifluoromethyl)-3,4-dihydropyrrol-2-amine |
| SMILES | C[C@]1(c2cc(N)ccc2F)N=C(N)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C12H13F4N3/c1-11(7-4-6(17)2-3-8(7)13)9(12(14,15)16)5-10(18)19-11/h2-4,9H,5,17H2,1H3,(H2,18,19)/t9-,11-/m1/s1 |
| InChIKey | KHOLPIUCYYIICR-MWLCHTKSSA-N |
| XLogP | 2.56 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|