C15H20F3N3OS — CID 130435179
2-[(4R,6S)-2-amino-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6-dimethyl-1,3-thiazin-6-yl]propan-2-ol (PubChem CID 130435179) has the molecular formula C15H20F3N3OS and a molecular weight of 347.41 g/mol. Its IUPAC name is 2-[(4R,6S)-2-amino-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6-dimethyl-1,3-thiazin-6-yl]propan-2-ol.
| Compound Name | 2-[(4R,6S)-2-amino-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6-dimethyl-1,3-thiazin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 130435179 |
| Molecular Formula | C15H20F3N3OS |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(4R,6S)-2-amino-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6-dimethyl-1,3-thiazin-6-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@]1(C)SC(N)=N[C@](C)(c2cc(N)ccc2F)C1(F)F |
| InChI | InChI=1S/C15H20F3N3OS/c1-12(2,22)14(4)15(17,18)13(3,21-11(20)23-14)9-7-8(19)5-6-10(9)16/h5-7,22H,19H2,1-4H3,(H2,20,21)/t13-,14+/m1/s1 |
| InChIKey | DOLYWTOVPKHIDC-KGLIPLIRSA-N |
| XLogP | 2.85 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|