C13H16F3N3O — CID 58304251
(4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine (PubChem CID 58304251) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is (4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine.
| Compound Name | (4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 58304251 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (4R)-4-(5-amino-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
| SMILES | CC1(C)OC(N)=N[C@](C)(c2cc(N)ccc2F)C1(F)F |
| InChI | InChI=1S/C13H16F3N3O/c1-11(2)13(15,16)12(3,19-10(18)20-11)8-6-7(17)4-5-9(8)14/h4-6H,17H2,1-3H3,(H2,18,19)/t12-/m1/s1 |
| InChIKey | CIHUYDSAZXEMCO-GFCCVEGCSA-N |
| XLogP | 2.38 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|