C14H18FN3S — CID 58377063
(4S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-propan-2-ylidene-5H-1,3-thiazin-2-amine (PubChem CID 58377063) has the molecular formula C14H18FN3S and a molecular weight of 279.38 g/mol. Its IUPAC name is (4S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-propan-2-ylidene-5H-1,3-thiazin-2-amine.
| Compound Name | (4S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-propan-2-ylidene-5H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 58377063 |
| Molecular Formula | C14H18FN3S |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (4S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-propan-2-ylidene-5H-1,3-thiazin-2-amine |
| SMILES | CC(C)=C1C[C@@](C)(c2cc(N)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C14H18FN3S/c1-8(2)12-7-14(3,18-13(17)19-12)10-6-9(16)4-5-11(10)15/h4-6H,7,16H2,1-3H3,(H2,17,18)/t14-/m0/s1 |
| InChIKey | REOQVTOUFGPCSV-AWEZNQCLSA-N |
| XLogP | 3.37 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|