C12H19ClN2S — CID 45260371
ethyl N'-(4-propan-2-ylphenyl)carbamimidothioate;hydrochloride (PubChem CID 45260371) has the molecular formula C12H19ClN2S and a molecular weight of 258.82 g/mol. Its IUPAC name is ethyl N'-(4-propan-2-ylphenyl)carbamimidothioate;hydrochloride.
| Compound Name | ethyl N'-(4-propan-2-ylphenyl)carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 45260371 |
| Molecular Formula | C12H19ClN2S |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl N'-(4-propan-2-ylphenyl)carbamimidothioate;hydrochloride |
| SMILES | CCS/C(N)=N\c1ccc(C(C)C)cc1.Cl |
| InChI | InChI=1S/C12H18N2S.ClH/c1-4-15-12(13)14-11-7-5-10(6-8-11)9(2)3;/h5-9H,4H2,1-3H3,(H2,13,14);1H |
| InChIKey | NKPKTWWIRCLACA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|