C19H23ClN2OS — CID 8776033
2-(2-chlorophenoxy)ethyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate (PubChem CID 8776033) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate.
| Compound Name | 2-(2-chlorophenoxy)ethyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 8776033 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl N'-[4-[(2R)-butan-2-yl]phenyl]carbamimidothioate |
| SMILES | CC[C@@H](C)c1ccc(/N=C(/N)SCCOc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H23ClN2OS/c1-3-14(2)15-8-10-16(11-9-15)22-19(21)24-13-12-23-18-7-5-4-6-17(18)20/h4-11,14H,3,12-13H2,1-2H3,(H2,21,22)/t14-/m1/s1 |
| InChIKey | SNGDPPPCRHFNRF-CQSZACIVSA-N |
| XLogP | 5.61 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|