C12H12F3N3S — CID 53244950
(4S)-4-(5-amino-2-fluorophenyl)-6-(difluoromethyl)-4-methyl-1,3-thiazin-2-amine (PubChem CID 53244950) has the molecular formula C12H12F3N3S and a molecular weight of 287.31 g/mol. Its IUPAC name is (4S)-4-(5-amino-2-fluorophenyl)-6-(difluoromethyl)-4-methyl-1,3-thiazin-2-amine.
| Compound Name | (4S)-4-(5-amino-2-fluorophenyl)-6-(difluoromethyl)-4-methyl-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 53244950 |
| Molecular Formula | C12H12F3N3S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (4S)-4-(5-amino-2-fluorophenyl)-6-(difluoromethyl)-4-methyl-1,3-thiazin-2-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)C=C(C(F)F)SC(N)=N1 |
| InChI | InChI=1S/C12H12F3N3S/c1-12(7-4-6(16)2-3-8(7)13)5-9(10(14)15)19-11(17)18-12/h2-5,10H,16H2,1H3,(H2,17,18)/t12-/m0/s1 |
| InChIKey | LVGOJWYIFGQICM-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|