C12H13F4N3S — CID 146162410
(4S,6S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 146162410) has the molecular formula C12H13F4N3S and a molecular weight of 307.32 g/mol. Its IUPAC name is (4S,6S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | (4S,6S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 146162410 |
| Molecular Formula | C12H13F4N3S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (4S,6S)-4-(5-amino-2-fluorophenyl)-4-methyl-6-(trifluoromethyl)-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | C[C@@]1(c2cc(N)ccc2F)C[C@@H](C(F)(F)F)SC(N)=N1 |
| InChI | InChI=1S/C12H13F4N3S/c1-11(7-4-6(17)2-3-8(7)13)5-9(12(14,15)16)20-10(18)19-11/h2-4,9H,5,17H2,1H3,(H2,18,19)/t9-,11-/m0/s1 |
| InChIKey | AIKFIHFDDRYOMQ-ONGXEEELSA-N |
| XLogP | 3.01 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|