C13H16FN3S — CID 53244759
(4S)-4-(5-amino-2-fluorophenyl)-6-ethyl-4-methyl-1,3-thiazin-2-amine (PubChem CID 53244759) has the molecular formula C13H16FN3S and a molecular weight of 265.36 g/mol. Its IUPAC name is (4S)-4-(5-amino-2-fluorophenyl)-6-ethyl-4-methyl-1,3-thiazin-2-amine.
| Compound Name | (4S)-4-(5-amino-2-fluorophenyl)-6-ethyl-4-methyl-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 53244759 |
| Molecular Formula | C13H16FN3S |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (4S)-4-(5-amino-2-fluorophenyl)-6-ethyl-4-methyl-1,3-thiazin-2-amine |
| SMILES | CCC1=C[C@@](C)(c2cc(N)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C13H16FN3S/c1-3-9-7-13(2,17-12(16)18-9)10-6-8(15)4-5-11(10)14/h4-7H,3,15H2,1-2H3,(H2,16,17)/t13-/m0/s1 |
| InChIKey | UGHSIHBVRJNJRH-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|