C15H17FN2OS — CID 123562240
4-ethynyl-4-(2-fluorophenyl)-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 123562240) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-ethynyl-4-(2-fluorophenyl)-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | 4-ethynyl-4-(2-fluorophenyl)-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 123562240 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-ethynyl-4-(2-fluorophenyl)-6-(2-methoxyethyl)-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | C#CC1(c2ccccc2F)CC(CCOC)SC(N)=N1 |
| InChI | InChI=1S/C15H17FN2OS/c1-3-15(12-6-4-5-7-13(12)16)10-11(8-9-19-2)20-14(17)18-15/h1,4-7,11H,8-10H2,2H3,(H2,17,18) |
| InChIKey | RMZCWVGETMKCSX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|