C16H15F3N2S — CID 144942818
(5R,9R)-9-ethynyl-2,2-difluoro-9-(2-fluorophenyl)-5-methyl-6-thia-8-azaspiro[3.5]non-7-en-7-amine (PubChem CID 144942818) has the molecular formula C16H15F3N2S and a molecular weight of 324.37 g/mol. Its IUPAC name is (5R,9R)-9-ethynyl-2,2-difluoro-9-(2-fluorophenyl)-5-methyl-6-thia-8-azaspiro[3.5]non-7-en-7-amine.
| Compound Name | (5R,9R)-9-ethynyl-2,2-difluoro-9-(2-fluorophenyl)-5-methyl-6-thia-8-azaspiro[3.5]non-7-en-7-amine |
|---|---|
| PubChem CID | 144942818 |
| Molecular Formula | C16H15F3N2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (5R,9R)-9-ethynyl-2,2-difluoro-9-(2-fluorophenyl)-5-methyl-6-thia-8-azaspiro[3.5]non-7-en-7-amine |
| SMILES | C#C[C@]1(c2ccccc2F)N=C(N)S[C@H](C)C12CC(F)(F)C2 |
| InChI | InChI=1S/C16H15F3N2S/c1-3-16(11-6-4-5-7-12(11)17)14(8-15(18,19)9-14)10(2)22-13(20)21-16/h1,4-7,10H,8-9H2,2H3,(H2,20,21)/t10-,16-/m1/s1 |
| InChIKey | UFNXURWZHJXBKM-QLJPJBMISA-N |
| XLogP | 3.52 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|