C11H13FOS — CID 124681288
(2R,3S)-3-(2-fluorophenyl)-2-methylthiolan-3-ol (PubChem CID 124681288) has the molecular formula C11H13FOS and a molecular weight of 212.29 g/mol. Its IUPAC name is (2R,3S)-3-(2-fluorophenyl)-2-methylthiolan-3-ol.
| Compound Name | (2R,3S)-3-(2-fluorophenyl)-2-methylthiolan-3-ol |
|---|---|
| PubChem CID | 124681288 |
| Molecular Formula | C11H13FOS |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (2R,3S)-3-(2-fluorophenyl)-2-methylthiolan-3-ol |
| SMILES | C[C@H]1SCC[C@]1(O)c1ccccc1F |
| InChI | InChI=1S/C11H13FOS/c1-8-11(13,6-7-14-8)9-4-2-3-5-10(9)12/h2-5,8,13H,6-7H2,1H3/t8-,11-/m1/s1 |
| InChIKey | QXOYBLLKITVZGM-LDYMZIIASA-N |
| XLogP | 2.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |