C12H14BrFOS — CID 106644484
3-(3-bromo-2-fluorophenyl)-2-methylthian-3-ol (PubChem CID 106644484) has the molecular formula C12H14BrFOS and a molecular weight of 305.21 g/mol. Its IUPAC name is 3-(3-bromo-2-fluorophenyl)-2-methylthian-3-ol.
| Compound Name | 3-(3-bromo-2-fluorophenyl)-2-methylthian-3-ol |
|---|---|
| PubChem CID | 106644484 |
| Molecular Formula | C12H14BrFOS |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-(3-bromo-2-fluorophenyl)-2-methylthian-3-ol |
| SMILES | CC1SCCCC1(O)c1cccc(Br)c1F |
| InChI | InChI=1S/C12H14BrFOS/c1-8-12(15,6-3-7-16-8)9-4-2-5-10(13)11(9)14/h2,4-5,8,15H,3,6-7H2,1H3 |
| InChIKey | HROIEMNPIHZBRP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |