C13H17FO — CID 124512737
(1R)-1-(2-fluorophenyl)-3,3-dimethylcyclopentan-1-ol (PubChem CID 124512737) has the molecular formula C13H17FO and a molecular weight of 208.28 g/mol. Its IUPAC name is (1R)-1-(2-fluorophenyl)-3,3-dimethylcyclopentan-1-ol.
| Compound Name | (1R)-1-(2-fluorophenyl)-3,3-dimethylcyclopentan-1-ol |
|---|---|
| PubChem CID | 124512737 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (1R)-1-(2-fluorophenyl)-3,3-dimethylcyclopentan-1-ol |
| SMILES | CC1(C)CC[C@](O)(c2ccccc2F)C1 |
| InChI | InChI=1S/C13H17FO/c1-12(2)7-8-13(15,9-12)10-5-3-4-6-11(10)14/h3-6,15H,7-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | UVGKIMPMEGYJHS-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |