C13H15FO2S — CID 171965109
3-(2-fluorophenyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171965109) has the molecular formula C13H15FO2S and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2-fluorophenyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171965109 |
| Molecular Formula | C13H15FO2S |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-(2-fluorophenyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1C2CCC1CC(O)(c1ccccc1F)C2 |
| InChI | InChI=1S/C13H15FO2S/c14-12-4-2-1-3-11(12)13(15)7-9-5-6-10(8-13)17(9)16/h1-4,9-10,15H,5-8H2 |
| InChIKey | XBFHTDGQDXZJBC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |