C15H19FO2S — CID 171959076
3-[(2-fluorophenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171959076) has the molecular formula C15H19FO2S and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-[(2-fluorophenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171959076 |
| Molecular Formula | C15H19FO2S |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1C2CCCC1CC(O)(Cc1ccccc1F)C2 |
| InChI | InChI=1S/C15H19FO2S/c16-14-7-2-1-4-11(14)8-15(17)9-12-5-3-6-13(10-15)19(12)18/h1-2,4,7,12-13,17H,3,5-6,8-10H2 |
| InChIKey | WSWCSGSZEBLEIP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |