C21H22F3N5O2S — CID 153447622
N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyrazine-2-carboxamide (PubChem CID 153447622) has the molecular formula C21H22F3N5O2S and a molecular weight of 465.50 g/mol. Its IUPAC name is N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 153447622 |
| Molecular Formula | C21H22F3N5O2S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyrazine-2-carboxamide |
| SMILES | CC(F)c1cnc(C(=O)Nc2ccc(F)c([C@]34CO[C@@H](C)C[C@@]3(F)CSC(N)=N4)c2)cn1 |
| InChI | InChI=1S/C21H22F3N5O2S/c1-11-6-20(24)10-32-19(25)29-21(20,9-31-11)14-5-13(3-4-15(14)23)28-18(30)17-8-26-16(7-27-17)12(2)22/h3-5,7-8,11-12H,6,9-10H2,1-2H3,(H2,25,29)(H,28,30)/t11-,12?,20+,21+/m0/s1 |
| InChIKey | USMWEHYCPCGAGW-PSIOGSABSA-N |
| XLogP | 3.67 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |