C19H21FN6O3S — CID 142391383
N-[6-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-2-pyridinyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 142391383) has the molecular formula C19H21FN6O3S and a molecular weight of 432.48 g/mol. Its IUPAC name is N-[6-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-2-pyridinyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[6-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-2-pyridinyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 142391383 |
| Molecular Formula | C19H21FN6O3S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[6-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-2-pyridinyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COc1cnc(C(=O)Nc2cccc([C@]34CO[C@@H](C)C[C@@]3(F)CSC(N)=N4)n2)cn1 |
| InChI | InChI=1S/C19H21FN6O3S/c1-11-6-18(20)10-30-17(21)26-19(18,9-29-11)13-4-3-5-14(24-13)25-16(27)12-7-23-15(28-2)8-22-12/h3-5,7-8,11H,6,9-10H2,1-2H3,(H2,21,26)(H,24,25,27)/t11-,18+,19+/m0/s1 |
| InChIKey | RABOSSIVMUCYMO-ZKWAXGPOSA-N |
| XLogP | 1.91 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |