C20H19F3N4O2S — CID 142391465
N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide (PubChem CID 142391465) has the molecular formula C20H19F3N4O2S and a molecular weight of 436.46 g/mol. Its IUPAC name is N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 142391465 |
| Molecular Formula | C20H19F3N4O2S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@]2(F)CSC(N)=N[C@@]2(c2cccc(NC(=O)c3ncc(F)cc3F)c2)CO1 |
| InChI | InChI=1S/C20H19F3N4O2S/c1-11-7-19(23)10-30-18(24)27-20(19,9-29-11)12-3-2-4-14(5-12)26-17(28)16-15(22)6-13(21)8-25-16/h2-6,8,11H,7,9-10H2,1H3,(H2,24,27)(H,26,28)/t11-,19+,20+/m0/s1 |
| InChIKey | VYCPPFIDOAZSBC-JJFKOLPGSA-N |
| XLogP | 3.39 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |