C22H23F3N4O2S — CID 159461301
N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyridine-2-carboxamide (PubChem CID 159461301) has the molecular formula C22H23F3N4O2S and a molecular weight of 464.51 g/mol. Its IUPAC name is N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 159461301 |
| Molecular Formula | C22H23F3N4O2S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]-4-fluorophenyl]-5-(1-fluoroethyl)pyridine-2-carboxamide |
| SMILES | CC(F)c1ccc(C(=O)Nc2ccc(F)c([C@]34CO[C@@H](C)C[C@@]3(F)CSC(N)=N4)c2)nc1 |
| InChI | InChI=1S/C22H23F3N4O2S/c1-12-8-21(25)11-32-20(26)29-22(21,10-31-12)16-7-15(4-5-17(16)24)28-19(30)18-6-3-14(9-27-18)13(2)23/h3-7,9,12-13H,8,10-11H2,1-2H3,(H2,26,29)(H,28,30)/t12-,13?,21+,22+/m0/s1 |
| InChIKey | RVORDAPICXXMCF-MKMHYKSNSA-N |
| XLogP | 4.28 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |