C22H19FN2O — CID 143599384
3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-methylisoindol-1-amine (PubChem CID 143599384) has the molecular formula C22H19FN2O and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-methylisoindol-1-amine.
| Compound Name | 3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-methylisoindol-1-amine |
|---|---|
| PubChem CID | 143599384 |
| Molecular Formula | C22H19FN2O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-methylisoindol-1-amine |
| SMILES | COc1cccc(-c2cccc(C3(C)N=C(N)c4ccccc43)c2)c1F |
| InChI | InChI=1S/C22H19FN2O/c1-22(18-11-4-3-9-17(18)21(24)25-22)15-8-5-7-14(13-15)16-10-6-12-19(26-2)20(16)23/h3-13H,1-2H3,(H2,24,25) |
| InChIKey | QXQBYHGDTAPWSH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |