C27H22N2O2 — CID 143599411
4-[3-amino-1-[3-(3-methoxyphenyl)phenyl]isoindol-1-yl]phenol (PubChem CID 143599411) has the molecular formula C27H22N2O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-[3-amino-1-[3-(3-methoxyphenyl)phenyl]isoindol-1-yl]phenol.
| Compound Name | 4-[3-amino-1-[3-(3-methoxyphenyl)phenyl]isoindol-1-yl]phenol |
|---|---|
| PubChem CID | 143599411 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-[3-amino-1-[3-(3-methoxyphenyl)phenyl]isoindol-1-yl]phenol |
| SMILES | COc1cccc(-c2cccc(C3(c4ccc(O)cc4)N=C(N)c4ccccc43)c2)c1 |
| InChI | InChI=1S/C27H22N2O2/c1-31-23-9-5-7-19(17-23)18-6-4-8-21(16-18)27(20-12-14-22(30)15-13-20)25-11-3-2-10-24(25)26(28)29-27/h2-17,30H,1H3,(H2,28,29) |
| InChIKey | RUBNVPBEACEGDZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |