C31H36N2O3S — CID 143599408
3-[3-[3-amino-1-(3-methylphenyl)-6,7-dihydroisoindol-1-yl]phenyl]-5-methoxyphenol;methanethiol;methoxymethane (PubChem CID 143599408) has the molecular formula C31H36N2O3S and a molecular weight of 516.71 g/mol. Its IUPAC name is 3-[3-[3-amino-1-(3-methylphenyl)-6,7-dihydroisoindol-1-yl]phenyl]-5-methoxyphenol;methanethiol;methoxymethane.
| Compound Name | 3-[3-[3-amino-1-(3-methylphenyl)-6,7-dihydroisoindol-1-yl]phenyl]-5-methoxyphenol;methanethiol;methoxymethane |
|---|---|
| PubChem CID | 143599408 |
| Molecular Formula | C31H36N2O3S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 3-[3-[3-amino-1-(3-methylphenyl)-6,7-dihydroisoindol-1-yl]phenyl]-5-methoxyphenol;methanethiol;methoxymethane |
| SMILES | COC.COc1cc(O)cc(-c2cccc(C3(c4cccc(C)c4)N=C(N)C4=C3CCC=C4)c2)c1.CS |
| InChI | InChI=1S/C28H26N2O2.C2H6O.CH4S/c1-18-7-5-9-21(13-18)28(26-12-4-3-11-25(26)27(29)30-28)22-10-6-8-19(14-22)20-15-23(31)17-24(16-20)32-2;1-3-2;1-2/h3,5-11,13-17,31H,4,12H2,1-2H3,(H2,29,30);1-2H3;2H,1H3 |
| InChIKey | XHZJDBSXXHVMCD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|